Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate (CAS: 692058-21-2)?

Answer

2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate
2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate is a white or off-white crystalline solid with a molecular weight of approximately 325.5 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. The compound is moderately reactive, particularly in basic conditions, and is stable under normal storage conditions but should be kept away from strong acids and oxidizers. It is commonly used as an intermediate in organic synthesis and pharmaceuticals.

About

English Name 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate
Molecular Formula C11H19F3N2O2
Molecular Weight 268.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCN(CC(F)(F)F)CC1
InChIKey YCMAOUJIMAOLCO-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate (CAS: 692058-21-2) typically synthesized?

2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate is typically synthesized throug...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate (CAS: 692058-21-2)?

2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate is primarily used in the pharma...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate (CAS: 692058-21-2)?

When handling 2-Methyl-2-propanyl 4-(2,2,2-trifluoroethyl)-1-piperazinecarboxylate, it is essential ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...