Compound Q&A

What precautions should be taken when handling 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS: 1161602-22-7)?

Answer

1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid
When handling 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid, it is essential to use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The compound should be stored in a cool, dry place away from heat sources. It should be handled in a well-ventilated area or fume hood to minimize inhalation risk. In case of a spill, it should be cleaned up immediately using appropriate absorbent materials. For detailed safety information, refer to the Material Safety Data Sheet (MSDS/SDS).

About

English Name 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid
Molecular Formula C12H13NO4
Molecular Weight 235.24 g/mol
SMILES C1CC(N(C1)C(=O)OC2=CC=CC=C2)C(=O)O
InChIKey OUPMLYISWFZSNV-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS: 1161602-22-7)?

1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid is a white crystalline solid at room temperature. I...

Compound Q&A

How is 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS: 1161602-22-7) typically synthesized?

1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid is synthesized through the condensation of phenol a...

Compound Q&A

What industries use 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS: 1161602-22-7)?

1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid is primarily used in the pharmaceutical industry as...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...