Compound Q&A

What are the physical and chemical properties of 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS: 1161602-22-7)?

Answer

1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid
1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid is a white crystalline solid at room temperature. Its molecular weight is approximately 289.23 g/mol. It is slightly soluble in water and moderately soluble in ethanol. The compound exhibits basic properties and can form salts with acids. It is stable under normal conditions but can undergo hydrolysis under acidic or basic conditions.

About

English Name 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid
Molecular Formula C12H13NO4
Molecular Weight 235.24 g/mol
SMILES C1CC(N(C1)C(=O)OC2=CC=CC=C2)C(=O)O
InChIKey OUPMLYISWFZSNV-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

How is 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS: 1161602-22-7) typically synthesized?

1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid is synthesized through the condensation of phenol a...

Compound Q&A

What industries use 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS: 1161602-22-7)?

1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid is primarily used in the pharmaceutical industry as...

Compound Q&A

What precautions should be taken when handling 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS: 1161602-22-7)?

When handling 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid, it is essential to use personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...