Compound Q&A

What industries use 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS: 1161602-22-7)?

Answer

1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid
1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid is primarily used in the pharmaceutical industry as a precursor for the synthesis of various biologically active compounds. It is also used in the polymer industry for the preparation of functionalized polymers and in the sensor industry for developing chemical sensors due to its reactivity and structural properties.

About

English Name 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid
Molecular Formula C12H13NO4
Molecular Weight 235.24 g/mol
SMILES C1CC(N(C1)C(=O)OC2=CC=CC=C2)C(=O)O
InChIKey OUPMLYISWFZSNV-UHFFFAOYSA-N
Last Updated: 2025-11-08 00:00

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS: 1161602-22-7)?

1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid is a white crystalline solid at room temperature. I...

Compound Q&A

How is 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS: 1161602-22-7) typically synthesized?

1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid is synthesized through the condensation of phenol a...

Compound Q&A

What precautions should be taken when handling 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS: 1161602-22-7)?

When handling 1-(Phenoxycarbonyl)pyrrolidine-2-carboxylic acid, it is essential to use personal prot...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...