Compound Q&A

What precautions should be taken when handling 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7)?

Answer

2-Ethylhexyl 3-cyclohexene-1-carboxylate
When handling 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7), it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Handle in a well-ventilated area or fume hood to prevent inhalation. Spills should be cleaned up using absorbent materials and disposed of according to local regulations. Always consult the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

CAS No 63302-64-7
English Name 2-Ethylhexyl 3-cyclohexene-1-carboxylate
Molecular Formula C15H26O2
Molecular Weight 238.37 g/mol
SMILES CCCCC(CC)COC(=O)C1CCC=CC1
InChIKey OOBVOBFENTULJB-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7)?

2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7) is a colorless to light yellow liquid wit...

Compound Q&A

How is 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7) typically synthesized?

2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7) is typically synthesized via a condensati...

Compound Q&A

What industries use 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7)?

2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7) is used in various industries. It finds a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...