Compound Q&A

What are the physical and chemical properties of 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7)?

Answer

2-Ethylhexyl 3-cyclohexene-1-carboxylate
2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7) is a colorless to light yellow liquid with a molecular weight of approximately 212.33 g/mol. It has a low melting point around -35°C and a boiling point of about 180°C. The compound is slightly soluble in water but miscible with common organic solvents like ethanol and acetone. It is reactive due to its unsaturated carbonyl functionality and can undergo typical organic reactions such as esterification and reduction.

About

CAS No 63302-64-7
English Name 2-Ethylhexyl 3-cyclohexene-1-carboxylate
Molecular Formula C15H26O2
Molecular Weight 238.37 g/mol
SMILES CCCCC(CC)COC(=O)C1CCC=CC1
InChIKey OOBVOBFENTULJB-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

How is 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7) typically synthesized?

2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7) is typically synthesized via a condensati...

Compound Q&A

What industries use 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7)?

2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7) is used in various industries. It finds a...

Compound Q&A

What precautions should be taken when handling 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7)?

When handling 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7), it is crucial to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...