Compound Q&A

What industries use 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7)?

Answer

2-Ethylhexyl 3-cyclohexene-1-carboxylate
2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7) is used in various industries. It finds applications in the pharmaceutical sector as a precursor in the synthesis of biologically active molecules. In the polymer industry, it serves as an additive to improve the flexibility and durability of polymer materials. Additionally, it is utilized in the production of sensors and semiconductors due to its unique chemical properties.

About

CAS No 63302-64-7
English Name 2-Ethylhexyl 3-cyclohexene-1-carboxylate
Molecular Formula C15H26O2
Molecular Weight 238.37 g/mol
SMILES CCCCC(CC)COC(=O)C1CCC=CC1
InChIKey OOBVOBFENTULJB-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7)?

2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7) is a colorless to light yellow liquid wit...

Compound Q&A

How is 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7) typically synthesized?

2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7) is typically synthesized via a condensati...

Compound Q&A

What precautions should be taken when handling 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7)?

When handling 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7), it is crucial to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...