Compound Q&A

How is 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7) typically synthesized?

Answer

2-Ethylhexyl 3-cyclohexene-1-carboxylate
2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7) is typically synthesized via a condensation reaction of 3-cyclohexene-1-carboxylic acid with 2-ethylhexanol in the presence of a suitable catalyst such as polyphosphoric acid. This process involves the formation of an ester bond, yielding the target compound with good yield and selectivity.

About

CAS No 63302-64-7
English Name 2-Ethylhexyl 3-cyclohexene-1-carboxylate
Molecular Formula C15H26O2
Molecular Weight 238.37 g/mol
SMILES CCCCC(CC)COC(=O)C1CCC=CC1
InChIKey OOBVOBFENTULJB-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7)?

2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7) is a colorless to light yellow liquid wit...

Compound Q&A

What industries use 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7)?

2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7) is used in various industries. It finds a...

Compound Q&A

What precautions should be taken when handling 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7)?

When handling 2-Ethylhexyl 3-cyclohexene-1-carboxylate (CAS: 63302-64-7), it is crucial to wear appr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...