Compound Q&A

What precautions should be taken when handling 2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4)?

Answer

2-(2-fluoro-4-nitrophenyl)acetic acid
When handling 2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4), it is essential to wear personal protective equipment (PPE) such as gloves, goggles, and a lab coat. The substance should be handled in a fume hood to minimize exposure. Spills should be cleaned up using appropriate absorbent materials and disposed of according to local regulations. Always refer to the Safety Data Sheet (SDS) for detailed handling instructions.

About

English Name 2-(2-fluoro-4-nitrophenyl)acetic acid
Molecular Formula C8H6FNO4
Molecular Weight 199.1359 g/mol
SMILES OC(=O)Cc1ccc(cc1F)[N+](=O)[O-]
InChIKey HKGNZXXYXCKJHO-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4)?

2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4) is a white crystalline solid with a molecul...

Compound Q&A

How is 2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4) typically synthesized?

2-(2-fluoro-4-nitrophenyl)acetic acid is synthesized through the nitration of 2-fluorophenylacetic a...

Compound Q&A

What industries use 2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4)?

2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4) finds applications in the pharmaceutical in...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...