Compound Q&A

How is 2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4) typically synthesized?

Answer

2-(2-fluoro-4-nitrophenyl)acetic acid
2-(2-fluoro-4-nitrophenyl)acetic acid is synthesized through the nitration of 2-fluorophenylacetic acid followed by the addition of nitric acid. The reaction is typically carried out under acidic conditions and requires careful control of temperature and reagent concentration to achieve the desired yield and selectivity.

About

English Name 2-(2-fluoro-4-nitrophenyl)acetic acid
Molecular Formula C8H6FNO4
Molecular Weight 199.1359 g/mol
SMILES OC(=O)Cc1ccc(cc1F)[N+](=O)[O-]
InChIKey HKGNZXXYXCKJHO-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4)?

2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4) is a white crystalline solid with a molecul...

Compound Q&A

What industries use 2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4)?

2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4) finds applications in the pharmaceutical in...

Compound Q&A

What precautions should be taken when handling 2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4)?

When handling 2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4), it is essential to wear pers...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...