Compound Q&A

What industries use 2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4)?

Answer

2-(2-fluoro-4-nitrophenyl)acetic acid
2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4) finds applications in the pharmaceutical industry for the synthesis of certain drugs, as a precursor in polymer chemistry, and in analytical chemistry for the development of sensors and reagents. It is also used in semiconductor manufacturing for etching and other processes.

About

English Name 2-(2-fluoro-4-nitrophenyl)acetic acid
Molecular Formula C8H6FNO4
Molecular Weight 199.1359 g/mol
SMILES OC(=O)Cc1ccc(cc1F)[N+](=O)[O-]
InChIKey HKGNZXXYXCKJHO-UHFFFAOYSA-N
Last Updated: 2025-11-07 19:01

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4)?

2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4) is a white crystalline solid with a molecul...

Compound Q&A

How is 2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4) typically synthesized?

2-(2-fluoro-4-nitrophenyl)acetic acid is synthesized through the nitration of 2-fluorophenylacetic a...

Compound Q&A

What precautions should be taken when handling 2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4)?

When handling 2-(2-fluoro-4-nitrophenyl)acetic acid (CAS: 315228-19-4), it is essential to wear pers...

Compound Q&A

Is 6-(3-Fluorophenyl)picolinic acid (CAS: 887982-40-3) safe?

6-(3-Fluorophenyl)picolinic acid is generally considered safe for laboratory use...

887982-40-36-(3-Fluorophenyl)pi...
Compound Q&A

What industries use (3R)-3-Pyrrolidinol (CAS: 2799-21-5)?

(3R)-3-Pyrrolidinol is used in the pharmaceutical industry as a precursor for dr...

2799-21-5(3R)-3-Pyrrolidinol
Compound Q&A

What precautions should be taken when handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-8)?

When handling (4R,5R)-4,5-Diethoxycarbonyl-2,2-dimethyldioxolane (CAS: 59779-75-...

59779-75-8(4R,5R)-4,5-Diethoxy...
Compound Q&A

How is 1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone (CAS: 90734-71-7) typically synthesized?

1-(6-Chloroimidazo[1,2-b]pyridazin-3-yl)ethanone is often synthesized via a mult...

90734-71-71-(6-Chloroimidazo[1...