Compound Q&A

What industries use 3-Bromo-2-chloroquinoline (CAS: 101870-60-4)?

Answer

3-Bromo-2-chloroquinoline
3-Bromo-2-chloroquinoline (CAS: 101870-60-4) is primarily used in the pharmaceutical industry for the synthesis of various drug intermediates. It also finds applications in the chemical industry for the production of dyes and other organic compounds. Additionally, it is used in the research of new sensor technologies and as a precursor in semiconductor manufacturing processes.

About

English Name 3-Bromo-2-chloroquinoline
Molecular Formula C9H5BrClN
Molecular Weight 242.5 g/mol
SMILES C1=CC=C2C(=C1)C=C(C(=N2)Cl)Br
InChIKey RWWUFTQVKMNRQN-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromo-2-chloroquinoline (CAS: 101870-60-4)?

3-Bromo-2-chloroquinoline (CAS: 101870-60-4) is a crystalline solid with a molecular weight of appro...

Compound Q&A

How is 3-Bromo-2-chloroquinoline (CAS: 101870-60-4) typically synthesized?

3-Bromo-2-chloroquinoline (CAS: 101870-60-4) is commonly synthesized via halogenation of quinoline w...

Compound Q&A

What precautions should be taken when handling 3-Bromo-2-chloroquinoline (CAS: 101870-60-4)?

When handling 3-Bromo-2-chloroquinoline (CAS: 101870-60-4), it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...