Compound Q&A

What are the physical and chemical properties of 3-Bromo-2-chloroquinoline (CAS: 101870-60-4)?

Answer

3-Bromo-2-chloroquinoline
3-Bromo-2-chloroquinoline (CAS: 101870-60-4) is a crystalline solid with a molecular weight of approximately 250.02 g/mol. It has a low solubility in water but is more soluble in organic solvents such as ethanol and acetone. Chemically, it is highly reactive and can undergo substitution reactions easily. It is also susceptible to hydrolysis under basic conditions.

About

English Name 3-Bromo-2-chloroquinoline
Molecular Formula C9H5BrClN
Molecular Weight 242.5 g/mol
SMILES C1=CC=C2C(=C1)C=C(C(=N2)Cl)Br
InChIKey RWWUFTQVKMNRQN-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

How is 3-Bromo-2-chloroquinoline (CAS: 101870-60-4) typically synthesized?

3-Bromo-2-chloroquinoline (CAS: 101870-60-4) is commonly synthesized via halogenation of quinoline w...

Compound Q&A

What industries use 3-Bromo-2-chloroquinoline (CAS: 101870-60-4)?

3-Bromo-2-chloroquinoline (CAS: 101870-60-4) is primarily used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 3-Bromo-2-chloroquinoline (CAS: 101870-60-4)?

When handling 3-Bromo-2-chloroquinoline (CAS: 101870-60-4), it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...