Compound Q&A

How is 3-Bromo-2-chloroquinoline (CAS: 101870-60-4) typically synthesized?

Answer

3-Bromo-2-chloroquinoline
3-Bromo-2-chloroquinoline (CAS: 101870-60-4) is commonly synthesized via halogenation of quinoline with bromine and chlorine in the presence of a base such as sodium hydroxide. The reaction is carried out under anhydrous conditions to avoid side reactions. The yield and selectivity can be optimized by controlling the reaction temperature and the ratio of reactants.

About

English Name 3-Bromo-2-chloroquinoline
Molecular Formula C9H5BrClN
Molecular Weight 242.5 g/mol
SMILES C1=CC=C2C(=C1)C=C(C(=N2)Cl)Br
InChIKey RWWUFTQVKMNRQN-UHFFFAOYSA-N
Last Updated: 2025-11-07 15:32

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-Bromo-2-chloroquinoline (CAS: 101870-60-4)?

3-Bromo-2-chloroquinoline (CAS: 101870-60-4) is a crystalline solid with a molecular weight of appro...

Compound Q&A

What industries use 3-Bromo-2-chloroquinoline (CAS: 101870-60-4)?

3-Bromo-2-chloroquinoline (CAS: 101870-60-4) is primarily used in the pharmaceutical industry for th...

Compound Q&A

What precautions should be taken when handling 3-Bromo-2-chloroquinoline (CAS: 101870-60-4)?

When handling 3-Bromo-2-chloroquinoline (CAS: 101870-60-4), it is essential to wear appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...