Compound Q&A

What industries use Muramidase (CAS: 9066-59-5)?

Answer

Muramidase
Muramidase finds applications in various industries. In the pharmaceutical sector, it is used for the development of diagnostic kits and as an enzyme component in antimicrobial treatments. In the food industry, it can be used to improve the quality of food products by breaking down bacterial cell walls. Additionally, it is used in the production of enzymes for biodegradable polymers and in biosensors for detecting bacterial contamination. Its use in semiconductors for cleaning and surface modification is also growing.

About

CAS No 9066-59-5
English Name Muramidase
Molecular Formula C125H196N40O36S2
Molecular Weight 2899.3 g/mol
SMILES CC(C)CC(C(=O)NC(CC(=O)O)C(=O)NC(CC(=O)N)C(=O)NC(CC1=CC=C(C=C1)O)C(=O)NC(CCCNC(=N)N)C(=O)NCC(=O)NC(CC2=CC=C(C=C2)O)C(=O)NC(CO)C(=O)NC(CC(C)C)C(=O)NCC(=O)NC(CC(=O)N)C(=O)O)NC(=O)CNC(=O)C(CC3=CN=CN3)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCCCN)NC(=O)C(CCSC)NC(=O)C(C)NC(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(CCC(=O)O)NC(=O)C(CS)NC(=O)C(CCCNC(=N)N)NC(=O)CNC(=O)C(CC4=CC=CC=C4)NC(=O)C(C(C)C)N
InChIKey JFXJPYIEDZSWNF-JWBGUOTLSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Muramidase (CAS: 9066-59-5)?

Muramidase, also known as N-acetylmuramidase, is a hydrolase enzyme. It has a molecular weight of ap...

Compound Q&A

How is Muramidase (CAS: 9066-59-5) typically synthesized?

Muramidase can be synthesized through genetic engineering techniques, such as expressing the gene en...

Compound Q&A

What precautions should be taken when handling Muramidase (CAS: 9066-59-5)?

When handling Muramidase, it is essential to wear appropriate personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...