Compound Q&A

How is Muramidase (CAS: 9066-59-5) typically synthesized?

Answer

Muramidase
Muramidase can be synthesized through genetic engineering techniques, such as expressing the gene encoding muramidase in heterologous hosts like E. coli. The enzyme is typically produced using recombinant DNA technology. The yield is influenced by factors such as the expression vector, host cell, and cultivation conditions. The process often involves expression in a host cell, followed by purification through column chromatography and other biochemical methods to obtain a homogeneous enzyme preparation.

About

CAS No 9066-59-5
English Name Muramidase
Molecular Formula C125H196N40O36S2
Molecular Weight 2899.3 g/mol
SMILES CC(C)CC(C(=O)NC(CC(=O)O)C(=O)NC(CC(=O)N)C(=O)NC(CC1=CC=C(C=C1)O)C(=O)NC(CCCNC(=N)N)C(=O)NCC(=O)NC(CC2=CC=C(C=C2)O)C(=O)NC(CO)C(=O)NC(CC(C)C)C(=O)NCC(=O)NC(CC(=O)N)C(=O)O)NC(=O)CNC(=O)C(CC3=CN=CN3)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCCCN)NC(=O)C(CCSC)NC(=O)C(C)NC(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(CCC(=O)O)NC(=O)C(CS)NC(=O)C(CCCNC(=N)N)NC(=O)CNC(=O)C(CC4=CC=CC=C4)NC(=O)C(C(C)C)N
InChIKey JFXJPYIEDZSWNF-JWBGUOTLSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Muramidase (CAS: 9066-59-5)?

Muramidase, also known as N-acetylmuramidase, is a hydrolase enzyme. It has a molecular weight of ap...

Compound Q&A

What industries use Muramidase (CAS: 9066-59-5)?

Muramidase finds applications in various industries. In the pharmaceutical sector, it is used for th...

Compound Q&A

What precautions should be taken when handling Muramidase (CAS: 9066-59-5)?

When handling Muramidase, it is essential to wear appropriate personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...