Compound Q&A

What are the physical and chemical properties of Muramidase (CAS: 9066-59-5)?

Answer

Muramidase
Muramidase, also known as N-acetylmuramidase, is a hydrolase enzyme. It has a molecular weight of approximately 45 kDa. Muramidase is highly soluble in water and is stable in neutral to slightly alkaline solutions. It is not significantly affected by common organic solvents. The enzyme exhibits high activity at a pH range of 6.0 to 8.0 and is most active at around pH 7.0. It is known for its broad substrate specificity and can hydrolyze the β-1,4-glycosidic bond in peptidoglycan, making it a valuable tool in the study of bacterial cell wall metabolism.

About

CAS No 9066-59-5
English Name Muramidase
Molecular Formula C125H196N40O36S2
Molecular Weight 2899.3 g/mol
SMILES CC(C)CC(C(=O)NC(CC(=O)O)C(=O)NC(CC(=O)N)C(=O)NC(CC1=CC=C(C=C1)O)C(=O)NC(CCCNC(=N)N)C(=O)NCC(=O)NC(CC2=CC=C(C=C2)O)C(=O)NC(CO)C(=O)NC(CC(C)C)C(=O)NCC(=O)NC(CC(=O)N)C(=O)O)NC(=O)CNC(=O)C(CC3=CN=CN3)NC(=O)C(CCCNC(=N)N)NC(=O)C(CCCCN)NC(=O)C(CCSC)NC(=O)C(C)NC(=O)C(C)NC(=O)C(C)NC(=O)C(CC(C)C)NC(=O)C(CCC(=O)O)NC(=O)C(CS)NC(=O)C(CCCNC(=N)N)NC(=O)CNC(=O)C(CC4=CC=CC=C4)NC(=O)C(C(C)C)N
InChIKey JFXJPYIEDZSWNF-JWBGUOTLSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is Muramidase (CAS: 9066-59-5) typically synthesized?

Muramidase can be synthesized through genetic engineering techniques, such as expressing the gene en...

Compound Q&A

What industries use Muramidase (CAS: 9066-59-5)?

Muramidase finds applications in various industries. In the pharmaceutical sector, it is used for th...

Compound Q&A

What precautions should be taken when handling Muramidase (CAS: 9066-59-5)?

When handling Muramidase, it is essential to wear appropriate personal protective equipment (PPE) su...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...