Compound Q&A

What precautions should be taken when handling (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0)?

Answer

(2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (1:1)
When handling (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0), it is essential to wear appropriate personal protective equipment (PPE), including gloves, goggles, and a lab coat. This compound should be stored in a cool, dry place away from direct sunlight and sources of heat. In case of a spill, it should be cleaned up immediately using appropriate absorbent materials and handled according to the safety data sheet (SDS) guidelines. It is also advisable to work in a well-ventilated area or fume hood to minimize exposure to airborne particles.

About

English Name (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (1:1)
Molecular Formula C9H16ClNO2
Molecular Weight 205.69 g/mol
SMILES C1CCC2C(C1)CC(N2)C(=O)O.Cl
InChIKey PONAUWFRJYNGAC-MWDCIYOWSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0)?

(2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0) is a white cryst...

Compound Q&A

How is (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0) typically synthesized?

(2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride can be synthesized through a multi-...

Compound Q&A

What industries use (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0)?

(2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0) is primarily use...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...