Compound Q&A

How is (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0) typically synthesized?

Answer

(2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (1:1)
(2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride can be synthesized through a multi-step process starting from indole. Common methods involve first reacting indole with a suitable acid chloride or anhydride to form the indole-2-carboxylic acid derivative, followed by hydrochloric acid treatment to form the hydrochloride salt. The reaction typically requires careful control of temperature and pH to achieve high yield and selectivity.

About

English Name (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (1:1)
Molecular Formula C9H16ClNO2
Molecular Weight 205.69 g/mol
SMILES C1CCC2C(C1)CC(N2)C(=O)O.Cl
InChIKey PONAUWFRJYNGAC-MWDCIYOWSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0)?

(2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0) is a white cryst...

Compound Q&A

What industries use (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0)?

(2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0) is primarily use...

Compound Q&A

What precautions should be taken when handling (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0)?

When handling (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...