Compound Q&A

What industries use (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0)?

Answer

(2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (1:1)
(2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0) is primarily used in the pharmaceutical industry for the synthesis of various indole-based drugs. It is also employed in the development of organic sensors and materials due to its unique chemical structure and reactivity. Additionally, its potential applications in the polymer industry for special functional polymers are being explored.

About

English Name (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (1:1)
Molecular Formula C9H16ClNO2
Molecular Weight 205.69 g/mol
SMILES C1CCC2C(C1)CC(N2)C(=O)O.Cl
InChIKey PONAUWFRJYNGAC-MWDCIYOWSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0)?

(2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0) is a white cryst...

Compound Q&A

How is (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0) typically synthesized?

(2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride can be synthesized through a multi-...

Compound Q&A

What precautions should be taken when handling (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0)?

When handling (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...