Compound Q&A

What are the physical and chemical properties of (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0)?

Answer

(2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (1:1)
(2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0) is a white crystalline solid with a molecular weight of approximately 224.67 g/mol. It is slightly soluble in water and more soluble in organic solvents such as ethanol and methanol. This compound is known for its reactivity with bases and is susceptible to hydrolysis. It is often used in organic synthesis due to its structural complexity and potential for further derivatization.

About

English Name (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (1:1)
Molecular Formula C9H16ClNO2
Molecular Weight 205.69 g/mol
SMILES C1CCC2C(C1)CC(N2)C(=O)O.Cl
InChIKey PONAUWFRJYNGAC-MWDCIYOWSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0) typically synthesized?

(2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride can be synthesized through a multi-...

Compound Q&A

What industries use (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0)?

(2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0) is primarily use...

Compound Q&A

What precautions should be taken when handling (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0)?

When handling (2S,3aR,7aS)-Octahydro-1H-indole-2-carboxylic acid hydrochloride (CAS: 144540-75-0), i...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...