Compound Q&A

What precautions should be taken when handling 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone (CAS: 175354-56-0)?

Answer

2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone
When handling 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone, it is important to use appropriate personal protective equipment (PPE) such as gloves, safety glasses, and a lab coat. Ensure the use of a fume hood to minimize inhalation risks. Handle the compound in a well-ventilated area to avoid exposure. Spills should be cleaned up immediately using appropriate absorbent materials, and the area should be ventilated thoroughly. Refer to the safety data sheet (SDS) for detailed handling and disposal instructions.

About

English Name 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone
Molecular Formula C6H5F3N2O2
Molecular Weight 194.11 g/mol
SMILES COc1nc(cc(=O)[nH]1)C(F)(F)F
InChIKey ILOOCRYHYUMTKL-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone (CAS: 175354-56-0)?

2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone is a white crystalline solid. Its molecular weight ...

Compound Q&A

How is 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone (CAS: 175354-56-0) typically synthesized?

2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone is typically synthesized by the reaction of 6-chlor...

Compound Q&A

What industries use 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone (CAS: 175354-56-0)?

2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone is used in various industries, including pharmaceut...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...