Compound Q&A

What industries use 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone (CAS: 175354-56-0)?

Answer

2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone
2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone is used in various industries, including pharmaceuticals, where it serves as a precursor for the synthesis of antiviral and antifungal drugs. It is also utilized in the polymer industry for its chemical reactivity and stability in organic media. Additionally, it finds applications in the production of sensors and semiconductors.

About

English Name 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone
Molecular Formula C6H5F3N2O2
Molecular Weight 194.11 g/mol
SMILES COc1nc(cc(=O)[nH]1)C(F)(F)F
InChIKey ILOOCRYHYUMTKL-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone (CAS: 175354-56-0)?

2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone is a white crystalline solid. Its molecular weight ...

Compound Q&A

How is 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone (CAS: 175354-56-0) typically synthesized?

2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone is typically synthesized by the reaction of 6-chlor...

Compound Q&A

What precautions should be taken when handling 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone (CAS: 175354-56-0)?

When handling 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone, it is important to use appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...