Compound Q&A

What are the physical and chemical properties of 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone (CAS: 175354-56-0)?

Answer

2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone
2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone is a white crystalline solid. Its molecular weight is approximately 252.09 g/mol. It has low solubility in water but is soluble in organic solvents like methanol and acetonitrile. The compound is relatively stable but can react with bases to form pyrimidine derivatives. It is commonly used in organic synthesis and pharmaceuticals due to its reactivity and stability.

About

English Name 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone
Molecular Formula C6H5F3N2O2
Molecular Weight 194.11 g/mol
SMILES COc1nc(cc(=O)[nH]1)C(F)(F)F
InChIKey ILOOCRYHYUMTKL-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone (CAS: 175354-56-0) typically synthesized?

2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone is typically synthesized by the reaction of 6-chlor...

Compound Q&A

What industries use 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone (CAS: 175354-56-0)?

2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone is used in various industries, including pharmaceut...

Compound Q&A

What precautions should be taken when handling 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone (CAS: 175354-56-0)?

When handling 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone, it is important to use appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...