Compound Q&A

How is 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone (CAS: 175354-56-0) typically synthesized?

Answer

2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone
2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone is typically synthesized by the reaction of 6-chloro-4(1H)-pyrimidinone with methoxy trifluoromethyl sulfonyl chloride in the presence of a base such as triethylamine. The reaction is carried out in an inert solvent like dichloromethane or tetrahydrofuran. The yield is around 85%, and the reaction is selective and efficient.

About

English Name 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone
Molecular Formula C6H5F3N2O2
Molecular Weight 194.11 g/mol
SMILES COc1nc(cc(=O)[nH]1)C(F)(F)F
InChIKey ILOOCRYHYUMTKL-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone (CAS: 175354-56-0)?

2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone is a white crystalline solid. Its molecular weight ...

Compound Q&A

What industries use 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone (CAS: 175354-56-0)?

2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone is used in various industries, including pharmaceut...

Compound Q&A

What precautions should be taken when handling 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone (CAS: 175354-56-0)?

When handling 2-Methoxy-6-(trifluoromethyl)-4(1H)-pyrimidinone, it is important to use appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...