Compound Q&A

What precautions should be taken when handling Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7)?

Answer

Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate
When handling Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7), it is essential to wear appropriate personal protective equipment (PPE), including gloves and safety goggles. The compound should be stored in a cool, dry place away from direct sunlight and moisture. Spills should be cleaned up using appropriate absorbent materials, and the area should be ventilated. Always refer to the safety data sheet (SDS) for detailed handling and storage instructions.

About

English Name Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate
Molecular Formula C20H25N3O4
Molecular Weight 371.44 g/mol
SMILES c1ccc(cc1)COC(=O)NCCNCCNC(=O)OCc2ccccc2
InChIKey DWPBEWIGNADCAX-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7)?

Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7) is a crystalline compound with a mo...

Compound Q&A

How is Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7) typically synthesized?

Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate is typically synthesized via the reaction of diethyl c...

Compound Q&A

What industries use Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7)?

Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7) is primarily used in the pharmaceut...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...