Compound Q&A

What are the physical and chemical properties of Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7)?

Answer

Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate
Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7) is a crystalline compound with a molecular weight of approximately 424.4 g/mol. It has limited solubility in water but is more soluble in organic solvents such as ethanol and acetone. The compound exhibits low reactivity under normal conditions but can undergo hydrolysis in the presence of moisture. It is stable under standard laboratory conditions.

About

English Name Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate
Molecular Formula C20H25N3O4
Molecular Weight 371.44 g/mol
SMILES c1ccc(cc1)COC(=O)NCCNCCNC(=O)OCc2ccccc2
InChIKey DWPBEWIGNADCAX-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

How is Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7) typically synthesized?

Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate is typically synthesized via the reaction of diethyl c...

Compound Q&A

What industries use Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7)?

Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7) is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7)?

When handling Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7), it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...