Compound Q&A

What industries use Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7)?

Answer

Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate
Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7) is primarily used in the pharmaceutical industry for the synthesis of certain drugs that require carbamate functionalities. It is also employed in the polymer industry as a crosslinking agent and in the production of functional polymers. Additionally, it has applications in the development of sensors and semiconductors due to its unique chemical properties.

About

English Name Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate
Molecular Formula C20H25N3O4
Molecular Weight 371.44 g/mol
SMILES c1ccc(cc1)COC(=O)NCCNCCNC(=O)OCc2ccccc2
InChIKey DWPBEWIGNADCAX-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7)?

Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7) is a crystalline compound with a mo...

Compound Q&A

How is Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7) typically synthesized?

Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate is typically synthesized via the reaction of diethyl c...

Compound Q&A

What precautions should be taken when handling Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7)?

When handling Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7), it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...