Compound Q&A

How is Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7) typically synthesized?

Answer

Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate
Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate is typically synthesized via the reaction of diethyl carbonate with 1,3-bis(benzylamino)propane. The process involves the formation of a carbamate intermediate, which is then purified to yield the final product. The reaction is carried out under mild conditions, and the use of a mild base like triethylamine can enhance the yield and selectivity.

About

English Name Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate
Molecular Formula C20H25N3O4
Molecular Weight 371.44 g/mol
SMILES c1ccc(cc1)COC(=O)NCCNCCNC(=O)OCc2ccccc2
InChIKey DWPBEWIGNADCAX-UHFFFAOYSA-N
Last Updated: 2025-11-07 12:11

Related Q&A

Compound Q&A

What are the physical and chemical properties of Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7)?

Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7) is a crystalline compound with a mo...

Compound Q&A

What industries use Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7)?

Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7) is primarily used in the pharmaceut...

Compound Q&A

What precautions should be taken when handling Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7)?

When handling Dibenzyl (iminodi-2,1-ethanediyl)biscarbamate (CAS: 160256-75-7), it is essential to w...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...