Compound Q&A

What industries use 5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid (CAS: 33282-25-6)?

Answer

5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid
5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid is primarily used in the pharmaceutical industry for the development of new drugs. It also finds applications in the synthesis of functional materials, such as sensors and semiconductors, due to its unique electronic properties. Additionally, it is used in the polymer industry for the modification of polymer properties and in the preparation of advanced composites.

About

CAS No 33282-25-6
English Name 5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid
Molecular Formula C10H6N2O5
Molecular Weight 234.16 g/mol
SMILES C1=CC(=CC=C1C2=CC(=NO2)C(=O)O)[N+](=O)[O-]
InChIKey GBRSPKXOFRTAHS-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid (CAS: 33282-25-6)?

5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid (CAS: 33282-25-6) typically synthesized?

5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid is typically synthesized via a multi-step process st...

Compound Q&A

What precautions should be taken when handling 5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid (CAS: 33282-25-6)?

When handling 5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid, it is important to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...