Compound Q&A

What are the physical and chemical properties of 5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid (CAS: 33282-25-6)?

Answer

5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid
5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid is a crystalline solid with a molecular weight of approximately 259.16 g/mol. It has a pKₐ of around 2.8 in water, indicating it is a weak acid. The compound is poorly soluble in water but has good solubility in organic solvents such as methanol and acetone. It is reactive towards nucleophiles due to the presence of the carboxylic acid group and the nitrophenyl substituent, which can participate in electrophilic aromatic substitution reactions.

About

CAS No 33282-25-6
English Name 5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid
Molecular Formula C10H6N2O5
Molecular Weight 234.16 g/mol
SMILES C1=CC(=CC=C1C2=CC(=NO2)C(=O)O)[N+](=O)[O-]
InChIKey GBRSPKXOFRTAHS-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

How is 5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid (CAS: 33282-25-6) typically synthesized?

5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid is typically synthesized via a multi-step process st...

Compound Q&A

What industries use 5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid (CAS: 33282-25-6)?

5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid is primarily used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling 5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid (CAS: 33282-25-6)?

When handling 5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid, it is important to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...