Compound Q&A

How is 5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid (CAS: 33282-25-6) typically synthesized?

Answer

5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid
5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid is typically synthesized via a multi-step process starting from 4-nitrobenzaldehyde and oxazole. The key steps involve the formation of an oxazoline intermediate, followed by the addition of a nucleophile to form the final product. Commonly, this involves the reaction of 4-nitrobenzaldehyde with oxazole in the presence of a base, followed by acidification to obtain the carboxylic acid.

About

CAS No 33282-25-6
English Name 5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid
Molecular Formula C10H6N2O5
Molecular Weight 234.16 g/mol
SMILES C1=CC(=CC=C1C2=CC(=NO2)C(=O)O)[N+](=O)[O-]
InChIKey GBRSPKXOFRTAHS-UHFFFAOYSA-N
Last Updated: 2025-11-05 07:29

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid (CAS: 33282-25-6)?

5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid is a crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use 5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid (CAS: 33282-25-6)?

5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid is primarily used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling 5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid (CAS: 33282-25-6)?

When handling 5-(4-Nitrophenyl)-1,2-oxazole-3-carboxylic acid, it is important to use personal prote...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...