Compound Q&A

What industries use Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2)?

Answer

Fmoc-Val-Cit-PAB-MMAE
Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2) is primarily used in the pharmaceutical industry for conjugation of antibodies and proteins. It is also utilized in the polymer industry for preparing functional polymers with specific properties. Additionally, it is applied in the semiconductor and sensor industries for creating functionalized devices and materials with enhanced performance.

About

English Name Fmoc-Val-Cit-PAB-MMAE
Molecular Formula C73H104N10O14
Molecular Weight 1345.69 g/mol
SMILES CC[C@@H]([C@H](N(C(=O)[C@H](C(C)C)NC(=O)[C@@H](N(C(=O)OCc1ccc(cc1)NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)OCC1c2ccccc2c2c1cccc2)CCCNC(=O)N)C)C(C)C)C)[C@@H](CC(=O)N1CCC[C@H]1[C@@H]([C@H](C(=O)N[C@@H]([C@H](c1ccccc1)O)C)C)OC)OC)C
InChIKey RHQGFVOXIOMBMC-UUMMFNFXSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2)?

Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2) is a crystalline compound with a molecular weight of appro...

Compound Q&A

How is Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2) typically synthesized?

Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2) is synthesized by coupling Fmoc-Val-Cit-PAB with MMAE (MMA...

Compound Q&A

What precautions should be taken when handling Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2)?

When handling Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2), it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...