Compound Q&A

How is Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2) typically synthesized?

Answer

Fmoc-Val-Cit-PAB-MMAE
Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2) is synthesized by coupling Fmoc-Val-Cit-PAB with MMAE (MMAE is a macromer derivative) using standard peptide coupling chemistry. The reaction typically involves activating the amino group of Val-Cit-PAB with Fmoc protection, followed by deprotection and coupling with MMAE. The process requires careful control of pH and temperature to ensure high yield and selectivity.

About

English Name Fmoc-Val-Cit-PAB-MMAE
Molecular Formula C73H104N10O14
Molecular Weight 1345.69 g/mol
SMILES CC[C@@H]([C@H](N(C(=O)[C@H](C(C)C)NC(=O)[C@@H](N(C(=O)OCc1ccc(cc1)NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)OCC1c2ccccc2c2c1cccc2)CCCNC(=O)N)C)C(C)C)C)[C@@H](CC(=O)N1CCC[C@H]1[C@@H]([C@H](C(=O)N[C@@H]([C@H](c1ccccc1)O)C)C)OC)OC)C
InChIKey RHQGFVOXIOMBMC-UUMMFNFXSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2)?

Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2) is a crystalline compound with a molecular weight of appro...

Compound Q&A

What industries use Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2)?

Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2) is primarily used in the pharmaceutical industry for conju...

Compound Q&A

What precautions should be taken when handling Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2)?

When handling Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2), it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...