Compound Q&A

What are the physical and chemical properties of Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2)?

Answer

Fmoc-Val-Cit-PAB-MMAE
Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2) is a crystalline compound with a molecular weight of approximately 738.7 g/mol. It has a low solubility in water but is soluble in organic solvents like DMSO and DMF. The compound is reactive towards nucleophiles and can undergo amidation reactions. It is stable under neutral and mildly acidic conditions but should be stored in dry conditions to avoid degradation.

About

English Name Fmoc-Val-Cit-PAB-MMAE
Molecular Formula C73H104N10O14
Molecular Weight 1345.69 g/mol
SMILES CC[C@@H]([C@H](N(C(=O)[C@H](C(C)C)NC(=O)[C@@H](N(C(=O)OCc1ccc(cc1)NC(=O)[C@@H](NC(=O)[C@H](C(C)C)NC(=O)OCC1c2ccccc2c2c1cccc2)CCCNC(=O)N)C)C(C)C)C)[C@@H](CC(=O)N1CCC[C@H]1[C@@H]([C@H](C(=O)N[C@@H]([C@H](c1ccccc1)O)C)C)OC)OC)C
InChIKey RHQGFVOXIOMBMC-UUMMFNFXSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

How is Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2) typically synthesized?

Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2) is synthesized by coupling Fmoc-Val-Cit-PAB with MMAE (MMA...

Compound Q&A

What industries use Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2)?

Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2) is primarily used in the pharmaceutical industry for conju...

Compound Q&A

What precautions should be taken when handling Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2)?

When handling Fmoc-Val-Cit-PAB-MMAE (CAS: 1350456-56-2), it is essential to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...