Compound Q&A

What precautions should be taken when handling 4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7)?

Answer

4-Bromo-N-methyl-2-nitroaniline
When handling 4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7), it is crucial to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated fume hood to minimize exposure. Spills should be cleaned up immediately with appropriate absorbent materials. Always refer to the Material Safety Data Sheet (MSDS) for detailed safety information and emergency procedures.

About

CAS No 53484-26-7
English Name 4-Bromo-N-methyl-2-nitroaniline
Molecular Formula C7H7BrN2O2
Molecular Weight 231.05 g/mol
SMILES CNC1=C(C=C(C=C1)Br)[N+](=O)[O-]
InChIKey IFTUKVAJYOQKRS-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7)?

4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7) is a white crystalline solid with a molecular weig...

Compound Q&A

How is 4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7) typically synthesized?

4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7) is typically synthesized via the nitration of 4-ch...

Compound Q&A

What industries use 4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7)?

4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7) is primarily used in the pharmaceutical industry a...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...