Compound Q&A

What industries use 4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7)?

Answer

4-Bromo-N-methyl-2-nitroaniline
4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7) is primarily used in the pharmaceutical industry as an intermediate in the synthesis of various drugs. It is also utilized in the production of dyes and pigments, and it plays a role in the development of sensors and semiconductors due to its unique chemical properties.

About

CAS No 53484-26-7
English Name 4-Bromo-N-methyl-2-nitroaniline
Molecular Formula C7H7BrN2O2
Molecular Weight 231.05 g/mol
SMILES CNC1=C(C=C(C=C1)Br)[N+](=O)[O-]
InChIKey IFTUKVAJYOQKRS-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7)?

4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7) is a white crystalline solid with a molecular weig...

Compound Q&A

How is 4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7) typically synthesized?

4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7) is typically synthesized via the nitration of 4-ch...

Compound Q&A

What precautions should be taken when handling 4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7)?

When handling 4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7), it is crucial to use appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...