Compound Q&A

How is 4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7) typically synthesized?

Answer

4-Bromo-N-methyl-2-nitroaniline
4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7) is typically synthesized via the nitration of 4-chloro-N-methylaniline followed by bromination. The process involves careful control of reaction conditions to achieve high yields and selectivity. Commonly used catalysts include sulfuric acid, and the reaction often requires cooling to maintain reactivity and control byproducts.

About

CAS No 53484-26-7
English Name 4-Bromo-N-methyl-2-nitroaniline
Molecular Formula C7H7BrN2O2
Molecular Weight 231.05 g/mol
SMILES CNC1=C(C=C(C=C1)Br)[N+](=O)[O-]
InChIKey IFTUKVAJYOQKRS-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7)?

4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7) is a white crystalline solid with a molecular weig...

Compound Q&A

What industries use 4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7)?

4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7) is primarily used in the pharmaceutical industry a...

Compound Q&A

What precautions should be taken when handling 4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7)?

When handling 4-Bromo-N-methyl-2-nitroaniline (CAS: 53484-26-7), it is crucial to use appropriate pe...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...