Compound Q&A

What industries use 4,5-Dichloro-3-nitro-2-pyridinamine (CAS: 662116-67-8)?

Answer

4,5-Dichloro-3-nitro-2-pyridinamine
4,5-Dichloro-3-nitro-2-pyridinamine finds applications in the pharmaceutical industry, where it serves as a precursor for drug synthesis. It is also used in the production of certain dyes and pigments, and in the development of chemical sensors and semiconductors due to its unique electronic properties.

About

English Name 4,5-Dichloro-3-nitro-2-pyridinamine
Molecular Formula C5H3Cl2N3O2
Molecular Weight 208 g/mol
SMILES Nc1ncc(Cl)c(Cl)c1[N+](=O)[O-]
InChIKey KYVDKOZOAOAFDC-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4,5-Dichloro-3-nitro-2-pyridinamine (CAS: 6621116-67-8)?

4,5-Dichloro-3-nitro-2-pyridinamine is a crystalline solid with a molecular weight of approximately ...

Compound Q&A

How is 4,5-Dichloro-3-nitro-2-pyridinamine (CAS: 662116-67-8) typically synthesized?

4,5-Dichloro-3-nitro-2-pyridinamine can be synthesized through a multi-step process involving the ni...

Compound Q&A

What precautions should be taken when handling 4,5-Dichloro-3-nitro-2-pyridinamine (CAS: 662116-67-8)?

Proper handling of 4,5-Dichloro-3-nitro-2-pyridinamine requires the use of personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...