Compound Q&A

What are the physical and chemical properties of 4,5-Dichloro-3-nitro-2-pyridinamine (CAS: 6621116-67-8)?

Answer

4,5-Dichloro-3-nitro-2-pyridinamine
4,5-Dichloro-3-nitro-2-pyridinamine is a crystalline solid with a molecular weight of approximately 240.04 g/mol. It has a low solubility in water but is more soluble in organic solvents like ethanol and acetone. Chemically, it is highly reactive due to the presence of electron-withdrawing nitro and chloro substituents, making it susceptible to nucleophilic substitution reactions.

About

English Name 4,5-Dichloro-3-nitro-2-pyridinamine
Molecular Formula C5H3Cl2N3O2
Molecular Weight 208 g/mol
SMILES Nc1ncc(Cl)c(Cl)c1[N+](=O)[O-]
InChIKey KYVDKOZOAOAFDC-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:31

Related Q&A

Compound Q&A

How is 4,5-Dichloro-3-nitro-2-pyridinamine (CAS: 662116-67-8) typically synthesized?

4,5-Dichloro-3-nitro-2-pyridinamine can be synthesized through a multi-step process involving the ni...

Compound Q&A

What industries use 4,5-Dichloro-3-nitro-2-pyridinamine (CAS: 662116-67-8)?

4,5-Dichloro-3-nitro-2-pyridinamine finds applications in the pharmaceutical industry, where it serv...

Compound Q&A

What precautions should be taken when handling 4,5-Dichloro-3-nitro-2-pyridinamine (CAS: 662116-67-8)?

Proper handling of 4,5-Dichloro-3-nitro-2-pyridinamine requires the use of personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...