Compound Q&A

What precautions should be taken when handling (2-Chlorophenyl)methanesulfonyl chloride (CAS: 77421-13-7)?

Answer

(2-Chlorophenyl)methanesulfonyl chloride
When handling (2-Chlorophenyl)methanesulfonyl chloride, appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat should be worn. Work should be conducted in a fume hood to minimize exposure to vapor. Spills should be handled by professional personnel with appropriate safety measures in place, and the substance should be stored in a cool, dry place away from heat sources. Safety data sheets (SDS) should be consulted for detailed handling instructions.

About

CAS No 77421-13-7
English Name (2-Chlorophenyl)methanesulfonyl chloride
Molecular Formula C7H6Cl2O2S
Molecular Weight 225.1 g/mol
SMILES C1=CC=C(C(=C1)CS(=O)(=O)Cl)Cl
InChIKey CHPZYFXSICSCNY-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2-Chlorophenyl)methanesulfonyl chloride (CAS: 77421-13-7)?

(2-Chlorophenyl)methanesulfonyl chloride is a white crystalline solid with a molecular weight of app...

Compound Q&A

How is (2-Chlorophenyl)methanesulfonyl chloride (CAS: 77421-13-7) typically synthesized?

(2-Chlorophenyl)methanesulfonyl chloride is usually synthesized by the reaction of 2-chlorophenylmet...

Compound Q&A

What industries use (2-Chlorophenyl)methanesulfonyl chloride (CAS: 77421-13-7)?

(2-Chlorophenyl)methanesulfonyl chloride is used in the pharmaceutical industry for synthesizing int...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...