Compound Q&A

What are the physical and chemical properties of (2-Chlorophenyl)methanesulfonyl chloride (CAS: 77421-13-7)?

Answer

(2-Chlorophenyl)methanesulfonyl chloride
(2-Chlorophenyl)methanesulfonyl chloride is a white crystalline solid with a molecular weight of approximately 220.59 g/mol. It has low water solubility but good solubility in organic solvents like dichloromethane and acetone. This compound is highly reactive, particularly with primary amines and alcohols. It is used in organic synthesis for its sulfonating properties.

About

CAS No 77421-13-7
English Name (2-Chlorophenyl)methanesulfonyl chloride
Molecular Formula C7H6Cl2O2S
Molecular Weight 225.1 g/mol
SMILES C1=CC=C(C(=C1)CS(=O)(=O)Cl)Cl
InChIKey CHPZYFXSICSCNY-UHFFFAOYSA-N
Last Updated: 2025-11-04 22:30

Related Q&A

Compound Q&A

How is (2-Chlorophenyl)methanesulfonyl chloride (CAS: 77421-13-7) typically synthesized?

(2-Chlorophenyl)methanesulfonyl chloride is usually synthesized by the reaction of 2-chlorophenylmet...

Compound Q&A

What industries use (2-Chlorophenyl)methanesulfonyl chloride (CAS: 77421-13-7)?

(2-Chlorophenyl)methanesulfonyl chloride is used in the pharmaceutical industry for synthesizing int...

Compound Q&A

What precautions should be taken when handling (2-Chlorophenyl)methanesulfonyl chloride (CAS: 77421-13-7)?

When handling (2-Chlorophenyl)methanesulfonyl chloride, appropriate personal protective equipment (P...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...