Compound Q&A

What precautions should be taken when handling 1,3,3-Trimethyl-6'-(1-piperidinyl)-1,3-dihydrospiro[indole-2,1-b][1,4]oxazine] (CAS: 114747-45-4)?

Answer

1,3,3-Trimethyl-6'-(1-piperidinyl)-1,3-dihydrospiro[indole-2,3'-naphtho[2,1-b][1,4]oxazine]
Handling this compound requires the use of personal protective equipment (PPE) including gloves, goggles, and a lab coat. It should be conducted in a well-ventilated area or under a fume hood. Spills should be handled carefully and neutralized with a suitable base, followed by thorough cleanup. Always refer to the Safety Data Sheet (SDS) for specific handling guidelines.

About

English Name 1,3,3-Trimethyl-6'-(1-piperidinyl)-1,3-dihydrospiro[indole-2,3'-naphtho[2,1-b][1,4]oxazine]
Molecular Formula C27H29N3O
Molecular Weight 411.55 g/mol
SMILES CN1c2ccccc2C(C21C=Nc1c(O2)cc(c2c1cccc2)N1CCCCC1)(C)C
InChIKey YAWJWXXKKHOMQT-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3,3-Trimethyl-6'-(1-piperidinyl)-1,3-dihydrospiro[indole-2,3'-naphtho[2,1-b][1,4]oxazine] (CAS: 114747-45-4)?

The compound has a crystalline form with a molecular weight of approximately 379.45 g/mol. It is sli...

Compound Q&A

How is 1,3,3-Trimethyl-6'-(1-piperidinyl)-1,3-dihydrospiro[indole-2,3'-naphtho[2,1-b][1,4]oxazine] (CAS: 114747-45-4) typically synthesized?

This compound is typically synthesized through a multistep reaction involving the condensation of a ...

Compound Q&A

What industries use 1,3,3-Trimethyl-6'-(1-piperidinyl)-1,3-dihydrospiro[indole-2,3'-naphtho[2,1-b][1,4]oxazine] (CAS: 114747-45-4)?

This compound is primarily used in the pharmaceutical industry, specifically in the development of n...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...