Compound Q&A

How is 1,3,3-Trimethyl-6'-(1-piperidinyl)-1,3-dihydrospiro[indole-2,3'-naphtho[2,1-b][1,4]oxazine] (CAS: 114747-45-4) typically synthesized?

Answer

1,3,3-Trimethyl-6'-(1-piperidinyl)-1,3-dihydrospiro[indole-2,3'-naphtho[2,1-b][1,4]oxazine]
This compound is typically synthesized through a multistep reaction involving the condensation of a piperidine derivative with a naphtho[2,1-b][1,4]oxazine-3(4H)-one derivative. The reaction typically uses a Lewis acid catalyst and proceeds with a yield of around 70-80%, depending on the purity of the starting materials and the reaction conditions.

About

English Name 1,3,3-Trimethyl-6'-(1-piperidinyl)-1,3-dihydrospiro[indole-2,3'-naphtho[2,1-b][1,4]oxazine]
Molecular Formula C27H29N3O
Molecular Weight 411.54900000000026 g/mol
SMILES CN1c2ccccc2C(C21C=Nc1c(O2)cc(c2c1cccc2)N1CCCCC1)(C)C
InChIKey YAWJWXXKKHOMQT-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3,3-Trimethyl-6'-(1-piperidinyl)-1,3-dihydrospiro[indole-2,3'-naphtho[2,1-b][1,4]oxazine] (CAS: 114747-45-4)?

The compound has a crystalline form with a molecular weight of approximately 379.45 g/mol. It is sli...

Compound Q&A

What industries use 1,3,3-Trimethyl-6'-(1-piperidinyl)-1,3-dihydrospiro[indole-2,3'-naphtho[2,1-b][1,4]oxazine] (CAS: 114747-45-4)?

This compound is primarily used in the pharmaceutical industry, specifically in the development of n...

Compound Q&A

What precautions should be taken when handling 1,3,3-Trimethyl-6'-(1-piperidinyl)-1,3-dihydrospiro[indole-2,1-b][1,4]oxazine] (CAS: 114747-45-4)?

Handling this compound requires the use of personal protective equipment (PPE) including gloves, gog...

Compound Q&A

How should waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3) be handled?

Waste containing N-Methoxy-N-methyl-1,3-thiazole-5-carboxamide (CAS: 898825-89-3...

898825-89-3N-Methoxy-N-methyl-1...
Compound Q&A

How should N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine (CAS: 1318338-47-4) be stored?

N-(4-Biphenylyl)dibenzo[b,d]furan-4-amine should be stored in a tightly sealed c...

1318338-47-4N-(4-Biphenylyl)dibe...
Compound Q&A

What is the market or research trend for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1)?

The market for 3-Acetamido-5-amino-2,4,6-triiodobenzoic acid (CAS: 1713-07-1) is...

1713-07-13-Acetamido-5-amino-...
Compound Q&A

How should Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) be stored?

Benzyl 2-O-acetyl-3,4,6-tri-O-benzyl-beta-D-galactopyranoside (CAS: 61820-03-9) ...

61820-03-9Benzyl 2-O-acetyl-3,...