Compound Q&A

What industries use 1,3,3-Trimethyl-6'-(1-piperidinyl)-1,3-dihydrospiro[indole-2,3'-naphtho[2,1-b][1,4]oxazine] (CAS: 114747-45-4)?

Answer

1,3,3-Trimethyl-6'-(1-piperidinyl)-1,3-dihydrospiro[indole-2,3'-naphtho[2,1-b][1,4]oxazine]
This compound is primarily used in the pharmaceutical industry, specifically in the development of new drugs targeting various biological pathways. It is also utilized in the production of sensors and semiconductors, where its unique chemical properties are leveraged for their specific applications.

About

English Name 1,3,3-Trimethyl-6'-(1-piperidinyl)-1,3-dihydrospiro[indole-2,3'-naphtho[2,1-b][1,4]oxazine]
Molecular Formula C27H29N3O
Molecular Weight 411.55 g/mol
SMILES CN1c2ccccc2C(C21C=Nc1c(O2)cc(c2c1cccc2)N1CCCCC1)(C)C
InChIKey YAWJWXXKKHOMQT-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,3,3-Trimethyl-6'-(1-piperidinyl)-1,3-dihydrospiro[indole-2,3'-naphtho[2,1-b][1,4]oxazine] (CAS: 114747-45-4)?

The compound has a crystalline form with a molecular weight of approximately 379.45 g/mol. It is sli...

Compound Q&A

How is 1,3,3-Trimethyl-6'-(1-piperidinyl)-1,3-dihydrospiro[indole-2,3'-naphtho[2,1-b][1,4]oxazine] (CAS: 114747-45-4) typically synthesized?

This compound is typically synthesized through a multistep reaction involving the condensation of a ...

Compound Q&A

What precautions should be taken when handling 1,3,3-Trimethyl-6'-(1-piperidinyl)-1,3-dihydrospiro[indole-2,1-b][1,4]oxazine] (CAS: 114747-45-4)?

Handling this compound requires the use of personal protective equipment (PPE) including gloves, gog...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...