Compound Q&A

What precautions should be taken when handling 7-Hydroxyquinoline-3-carboxylic acid (CAS: 659730-27-5)?

Answer

7-Hydroxyquinoline-3-carboxylic acid
When handling 7-Hydroxyquinoline-3-carboxylic acid, it is important to use personal protective equipment (PPE) such as gloves, goggles, and lab coats. Store it in a well-ventilated area and use a fume hood during operations. In case of a spill, immediately contain it with appropriate materials and follow the safety data sheet (SDS) for disposal. Always consult the SDS for detailed safety guidelines.

About

English Name 7-Hydroxyquinoline-3-carboxylic acid
Molecular Formula C10H7NO3
Molecular Weight 189.17 g/mol
SMILES C1=CC(=CC2=NC=C(C=C21)C(=O)O)O
InChIKey RFVSBXGQVAGYJQ-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Hydroxyquinoline-3-carboxylic acid (CAS: 659730-27-5)?

7-Hydroxyquinoline-3-carboxylic acid is a crystalline solid with a molecular weight of approximately...

Compound Q&A

How is 7-Hydroxyquinoline-3-carboxylic acid (CAS: 659730-27-5) typically synthesized?

7-Hydroxyquinoline-3-carboxylic acid can be synthesized through the condensation of 4-hydroxyquinoli...

Compound Q&A

What industries use 7-Hydroxyquinoline-3-carboxylic acid (CAS: 659730-27-5)?

7-Hydroxyquinoline-3-carboxylic acid is used in various industries such as pharmaceuticals, where it...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...