Compound Q&A

What are the physical and chemical properties of 7-Hydroxyquinoline-3-carboxylic acid (CAS: 659730-27-5)?

Answer

7-Hydroxyquinoline-3-carboxylic acid
7-Hydroxyquinoline-3-carboxylic acid is a crystalline solid with a molecular weight of approximately 206.18 g/mol. It has a solubility of about 2.8 g/L in water at 20°C and is slightly soluble in ethanol and acetone. Chemically, it is reactive towards bases and can form salts with various cations. It exhibits weak acidity due to the carboxylic acid group.

About

English Name 7-Hydroxyquinoline-3-carboxylic acid
Molecular Formula C10H7NO3
Molecular Weight 189.17 g/mol
SMILES C1=CC(=CC2=NC=C(C=C21)C(=O)O)O
InChIKey RFVSBXGQVAGYJQ-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

How is 7-Hydroxyquinoline-3-carboxylic acid (CAS: 659730-27-5) typically synthesized?

7-Hydroxyquinoline-3-carboxylic acid can be synthesized through the condensation of 4-hydroxyquinoli...

Compound Q&A

What industries use 7-Hydroxyquinoline-3-carboxylic acid (CAS: 659730-27-5)?

7-Hydroxyquinoline-3-carboxylic acid is used in various industries such as pharmaceuticals, where it...

Compound Q&A

What precautions should be taken when handling 7-Hydroxyquinoline-3-carboxylic acid (CAS: 659730-27-5)?

When handling 7-Hydroxyquinoline-3-carboxylic acid, it is important to use personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...