Compound Q&A

What industries use 7-Hydroxyquinoline-3-carboxylic acid (CAS: 659730-27-5)?

Answer

7-Hydroxyquinoline-3-carboxylic acid
7-Hydroxyquinoline-3-carboxylic acid is used in various industries such as pharmaceuticals, where it serves as a precursor for drug development, and in the production of sensors and semiconductors. It is also explored in the synthesis of dyes and pigments due to its unique chemical properties.

About

English Name 7-Hydroxyquinoline-3-carboxylic acid
Molecular Formula C10H7NO3
Molecular Weight 189.17 g/mol
SMILES C1=CC(=CC2=NC=C(C=C21)C(=O)O)O
InChIKey RFVSBXGQVAGYJQ-UHFFFAOYSA-N
Last Updated: 2025-11-04 13:04

Related Q&A

Compound Q&A

What are the physical and chemical properties of 7-Hydroxyquinoline-3-carboxylic acid (CAS: 659730-27-5)?

7-Hydroxyquinoline-3-carboxylic acid is a crystalline solid with a molecular weight of approximately...

Compound Q&A

How is 7-Hydroxyquinoline-3-carboxylic acid (CAS: 659730-27-5) typically synthesized?

7-Hydroxyquinoline-3-carboxylic acid can be synthesized through the condensation of 4-hydroxyquinoli...

Compound Q&A

What precautions should be taken when handling 7-Hydroxyquinoline-3-carboxylic acid (CAS: 659730-27-5)?

When handling 7-Hydroxyquinoline-3-carboxylic acid, it is important to use personal protective equip...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...