Compound Q&A

How should waste containing 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8) be handled?

Answer

3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate
Waste containing 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8) should be handled according to local and international regulations. It is advisable to collect waste in appropriate containers, ensuring containment to prevent spillage. The waste should be neutralized if necessary and then disposed of through a professional waste disposal service. Environmental protection measures include proper labeling and documentation to comply with regulations and minimize environmental impact.

About

English Name 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate
Molecular Formula C11H19NO5
Molecular Weight 245.27499999999998 g/mol
SMILES COC(=O)C1COCCN1C(=O)OC(C)(C)C
InChIKey KHKJMJAQUGFIHO-UHFFFAOYSA-N
Last Updated: 2025-11-03 09:36

Related Q&A

Compound Q&A

What regulatory guidelines apply to 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8)?

3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8) falls under various ...

Compound Q&A

Are there alternatives to 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8) in synthesis?

There are alternatives to 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-...

Compound Q&A

What is the market or research trend for 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8)?

The market for 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8) is cu...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...