Compound Q&A

Are there alternatives to 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8) in synthesis?

Answer

3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate
There are alternatives to 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8) in synthesis. Common alternatives include similar carboxylic acid derivatives, such as 3,4-dimethylmorpholine or 3-ethyl-4-(2-methyl-2-propanyl)morpholine. These alternatives can be used based on the specific requirements of the synthesis, such as reactivity, solubility, or cost.

About

English Name 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate
Molecular Formula C11H19NO5
Molecular Weight 245.27499999999998 g/mol
SMILES COC(=O)C1COCCN1C(=O)OC(C)(C)C
InChIKey KHKJMJAQUGFIHO-UHFFFAOYSA-N
Last Updated: 2025-11-03 09:36

Related Q&A

Compound Q&A

What regulatory guidelines apply to 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8)?

3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8) falls under various ...

Compound Q&A

What is the market or research trend for 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8)?

The market for 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8) is cu...

Compound Q&A

How should waste containing 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8) be handled?

Waste containing 3-Methyl 4-(2-methyl-2-propanyl) 3,4-morpholinedicarboxylate (CAS: 212650-45-8) sho...

Compound Q&A

How is 3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride (CAS: 1187830-80-3) typically synthesized?

3-(2-Bromoimidazo[2,1-b]thiazol-6-yl)propanoic acid hydrochloride is typically s...

1187830-80-33-(2-Bromoimidazo[2,...
Compound Q&A

How is 2-Isopropyl-1,3-dioxane-5-carboxylic acid (CAS: 116193-72-7) typically synthesized?

2-Isopropyl-1,3-dioxane-5-carboxylic acid is typically synthesized by the carbox...

116193-72-72-Isopropyl-1,3-diox...
Compound Q&A

What is Alisporivir (CAS: 254435-95-5)?

Alisporivir (CAS: 254435-95-5) is an antiviral medication used in the treatment ...

254435-95-5Alisporivir
Compound Q&A

What are the physical and chemical properties of [1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0)?

[1,2,4]triazolo[3,4-a]phthalazine (CAS: 234-80-0) is a crystalline compound with...

234-80-0[1,2,4]triazolo[3,4-...